EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O5 |
| Net Charge | 0 |
| Average Mass | 158.109 |
| Monoisotopic Mass | 158.02152 |
| SMILES | O=C(O)/C=C\C(=O)CC(=O)O |
| InChI | InChI=1S/C6H6O5/c7-4(3-6(10)11)1-2-5(8)9/h1-2H,3H2,(H,8,9)(H,10,11)/b2-1- |
| InChIKey | SOXXPQLIZIPMIZ-UPHRSURJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maleylacetic acid (CHEBI:1184) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| maleylacetic acid (CHEBI:1184) is a 4-oxohex-2-enedioic acid (CHEBI:19672) |
| maleylacetic acid (CHEBI:1184) is conjugate acid of maleylacetate (CHEBI:16468) |
| Incoming Relation(s) |
| 2-chloromaleylacetic acid (CHEBI:28489) has functional parent maleylacetic acid (CHEBI:1184) |
| maleylacetate (CHEBI:16468) is conjugate base of maleylacetic acid (CHEBI:1184) |
| IUPAC Name |
|---|
| (2Z)-4-oxohex-2-enedioic acid |
| Synonyms | Source |
|---|---|
| 2-Maleylacetate | KEGG COMPOUND |
| 4-Oxohex-2-enedioate | KEGG COMPOUND |
| (Z)-4-oxo-2-hexenedioic acid | ChemIDplus |
| Maleylacetate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8544937 | Reaxys |
| CAS:24740-88-3 | ChemIDplus |
| CAS:24740-88-3 | KEGG COMPOUND |
| Citations |
|---|