EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O7 |
| Net Charge | 0 |
| Average Mass | 196.155 |
| Monoisotopic Mass | 196.05830 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A2121h]/1/ |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3+,4-,5+/m0/s1 |
| InChIKey | RGHNJXZEOKUKBD-SKNVOMKLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (14973046) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-idonic acid (CHEBI:21336) has role Escherichia coli metabolite (CHEBI:76971) |
| L-idonic acid (CHEBI:21336) is a idonic acid (CHEBI:21337) |
| L-idonic acid (CHEBI:21336) is conjugate acid of L-idonate (CHEBI:17796) |
| Incoming Relation(s) |
| 2-dehydro-L-idonic acid (CHEBI:19543) has functional parent L-idonic acid (CHEBI:21336) |
| L-idonate (CHEBI:17796) is conjugate base of L-idonic acid (CHEBI:21336) |
| IUPAC Name |
|---|
| L-idonic acid |
| Manual Xrefs | Databases |
|---|---|
| C00770 | KEGG COMPOUND |
| ECMDB21376 | ECMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726056 | Reaxys |
| CAS:1114-17-6 | KEGG COMPOUND |
| Citations |
|---|