EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO3 |
| Net Charge | 0 |
| Average Mass | 133.147 |
| Monoisotopic Mass | 133.07389 |
| SMILES | CCC(O)C(N)C(=O)O |
| InChI | InChI=1S/C5H11NO3/c1-2-3(7)4(6)5(8)9/h3-4,7H,2,6H2,1H3,(H,8,9) |
| InChIKey | LGVJIYCMHMKTPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxynorvaline (CHEBI:74112) has functional parent 2-aminopentanoic acid (CHEBI:19475) |
| 3-hydroxynorvaline (CHEBI:74112) is a non-proteinogenic amino acid derivative (CHEBI:83812) |
| 3-hydroxynorvaline (CHEBI:74112) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| 3-hydroxynorvaline |
| Synonym | Source |
|---|---|
| DL-β-hydroxynorvaline | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1757761 | Reaxys |
| CAS:2280-42-4 | ChemIDplus |