EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O4 |
| Net Charge | -2 |
| Average Mass | 240.214 |
| Monoisotopic Mass | 240.04336 |
| SMILES | O=C([O-])c1ccccc1-c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C14H10O4/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18/h1-8H,(H,15,16)(H,17,18)/p-2 |
| InChIKey | GWZCCUDJHOGOSO-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenate(2−) (CHEBI:23836) is a dicarboxylic acid dianion (CHEBI:28965) |
| diphenate(2−) (CHEBI:23836) is conjugate base of diphenate(1−) (CHEBI:19283) |
| Incoming Relation(s) |
| diphenate(1−) (CHEBI:19283) is conjugate acid of diphenate(2−) (CHEBI:23836) |
| IUPAC Name |
|---|
| [1,1'-biphenyl]-2,2'-dicarboxylate |
| Synonyms | Source |
|---|---|
| 1,1'-biphenyl-2,2'-dicarboxylate | UM-BBD |
| 2,2'-biphenyldicarboxylate | UM-BBD |
| 2,2'-diphenate | UM-BBD |
| biphenyl-2,2'-dicarboxylate | IUPAC |
| diphenate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| c0512 | UM-BBD |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3678037 | Reaxys |
| Gmelin:536421 | Gmelin |