EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19N2O7 |
| Net Charge | -1 |
| Average Mass | 303.291 |
| Monoisotopic Mass | 303.11977 |
| SMILES | O=C([O-])[C@H](CC[NH+]1CC[C@H]1C(=O)[O-])[NH2+]CC[C@H](O)C(=O)[O-] |
| InChI | InChI=1S/C12H20N2O7/c15-9(12(20)21)1-4-13-7(10(16)17)2-5-14-6-3-8(14)11(18)19/h7-9,13,15H,1-6H2,(H,16,17)(H,18,19)(H,20,21)/p-1/t7-,8-,9-/m0/s1 |
| InChIKey | CUZKLRTTYZOCSD-CIUDSAMLSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-deoxymugineate (CHEBI:58487) is a amino-acid zwitterion (CHEBI:35238) |
| 2'-deoxymugineate (CHEBI:58487) is a tricarboxylic acid trianion (CHEBI:27092) |
| 2'-deoxymugineate (CHEBI:58487) is conjugate base of 2'-deoxymugineic acid (CHEBI:19274) |
| Incoming Relation(s) |
| 2'-deoxymugineic acid (CHEBI:19274) is conjugate acid of 2'-deoxymugineate (CHEBI:58487) |
| IUPAC Name |
|---|
| (2S)-1-[(3S)-3-carboxylato-3-{[(3S)-3-carboxylato-3-hydroxypropyl]ammonio}propyl]azetidinium-2-carboxylate |
| UniProt Name | Source |
|---|---|
| 2'-deoxymugineate | UniProt |