EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O7 |
| Net Charge | 0 |
| Average Mass | 262.218 |
| Monoisotopic Mass | 262.08010 |
| SMILES | CC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14N2O7/c1-4(13)10-6(3-12)8(16)11-5(9(17)18)2-7(14)15/h5-6,12H,2-3H2,1H3,(H,10,13)(H,11,16)(H,14,15)(H,17,18)/t5-,6-/m0/s1 |
| InChIKey | GFPWFSOXDSNMDC-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-seryl-L-aspartic acid (CHEBI:191173) has functional parent N-acetyl-L-serine (CHEBI:45441) |
| N-acetyl-L-seryl-L-aspartic acid (CHEBI:191173) has functional parent L-aspartic acid (CHEBI:17053) |
| N-acetyl-L-seryl-L-aspartic acid (CHEBI:191173) is a dipeptide (CHEBI:46761) |
| N-acetyl-L-seryl-L-aspartic acid (CHEBI:191173) is conjugate acid of N-acetyl-L-seryl-L-aspartate(2−) (CHEBI:190702) |
| Incoming Relation(s) |
| N-acetyl-L-seryl-L-aspartate(2−) (CHEBI:190702) is conjugate base of N-acetyl-L-seryl-L-aspartic acid (CHEBI:191173) |
| IUPAC Name |
|---|
| N-acetyl-L-seryl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-{[(2S)-2-acetamido-3-hydroxypropanoyl]amino}butanedioic acid | IUPAC |
| N-acetyl-serylaspartic acid | ChEBI |
| N-acetyl-L-Ser-L-Asp | ChEBI |
| N-Ac-Ser-Asp | ChEBI |
| N-Ac-Ser-Asp-OH | ChEBI |
| N-Ac-L-Ser-L-Asp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 23158290 | ChemSpider |
| HMDB0062501 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:127103-06-4 | HMDB |
| Citations |
|---|