EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | CC(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c1-3(8)6-4(2-7)5(9)10/h4,7H,2H2,1H3,(H,6,8)(H,9,10)/t4-/m0/s1 |
| InChIKey | JJIHLJJYMXLCOY-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | |||
| - | PubMed (20581114) | ||
| - | MetaboLights (MTBLS37) | ||
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS150) | ||
| - | PubMed (25518943) | Metabolite observed in cancer metabolism. | |
| - | MetaboLights (MTBLS150) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-serine (CHEBI:45441) has role human metabolite (CHEBI:77746) |
| N-acetyl-L-serine (CHEBI:45441) is a N-acetyl-L-amino acid (CHEBI:21545) |
| N-acetyl-L-serine (CHEBI:45441) is a acetyl-L-serine (CHEBI:22194) |
| Incoming Relation(s) |
| N-acetyl-L-seryl-L-aspartic acid (CHEBI:191173) has functional parent N-acetyl-L-serine (CHEBI:45441) |
| N-terminal N-acetyl-L-serine residue (CHEBI:83690) is substituent group from N-acetyl-L-serine (CHEBI:45441) |
| IUPAC Name |
|---|
| N-acetylserine |
| Manual Xrefs | Databases |
|---|---|
| 312807 | ChemSpider |
| HMDB0002931 | HMDB |
| SAC | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724424 | Reaxys |
| CAS:16354-58-8 | ChemIDplus |
| Citations |
|---|