EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O7 |
| Net Charge | -2 |
| Average Mass | 260.202 |
| Monoisotopic Mass | 260.06555 |
| SMILES | CC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H14N2O7/c1-4(13)10-6(3-12)8(16)11-5(9(17)18)2-7(14)15/h5-6,12H,2-3H2,1H3,(H,10,13)(H,11,16)(H,14,15)(H,17,18)/p-2/t5-,6-/m0/s1 |
| InChIKey | GFPWFSOXDSNMDC-WDSKDSINSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-seryl-L-aspartate(2−) (CHEBI:190702) is a peptide anion (CHEBI:60334) |
| N-acetyl-L-seryl-L-aspartate(2−) (CHEBI:190702) is conjugate base of N-acetyl-L-seryl-L-aspartic acid (CHEBI:191173) |
| Incoming Relation(s) |
| N-acetyl-L-seryl-L-aspartic acid (CHEBI:191173) is conjugate acid of N-acetyl-L-seryl-L-aspartate(2−) (CHEBI:190702) |
| IUPAC Name |
|---|
| (2S)-2-[(N-acetyl-L-seryl)amino]butanedioate |
| Synonyms | Source |
|---|---|
| N-acetyl-serylaspartic acid(2−) | ChEBI |
| N-acetyl-L-Ser-L-Asp(2−) | ChEBI |
| N-acetyl-L-seryl-L-aspartate dianion | ChEBI |
| N-Ac-SD(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| N-acetyl-L-seryl-L-aspartate | UniProt |
| Citations |
|---|