EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18N2O5 |
| Net Charge | 0 |
| Average Mass | 378.384 |
| Monoisotopic Mass | 378.12157 |
| SMILES | O=C(O)[C@H]1NCCN(C(=O)c2ccc3c(ccc4ccccc43)c2)[C@H]1C(=O)O |
| InChI | InChI=1S/C21H18N2O5/c24-19(23-10-9-22-17(20(25)26)18(23)21(27)28)14-7-8-16-13(11-14)6-5-12-3-1-2-4-15(12)16/h1-8,11,17-18,22H,9-10H2,(H,25,26)(H,27,28)/t17-,18+/m0/s1 |
| InChIKey | IWWXIZOMXGOTPP-ZWKOTPCHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3S)-PPDA (CHEBI:189871) has role NMDA receptor antagonist (CHEBI:60643) |
| (2R,3S)-PPDA (CHEBI:189871) is a 1-(phenanthren-2-ylcarbonyl)piperazine-2,3-dicarboxylic acid (CHEBI:189873) |
| (2R,3S)-PPDA (CHEBI:189871) is enantiomer of (2S,3R)-PPDA (CHEBI:189872) |
| Incoming Relation(s) |
| PPDA (CHEBI:189866) has part (2R,3S)-PPDA (CHEBI:189871) |
| (2S,3R)-PPDA (CHEBI:189872) is enantiomer of (2R,3S)-PPDA (CHEBI:189871) |
| IUPAC Name |
|---|
| (2R,3S)-1-(phenanthren-2-ylcarbonyl)piperazine-2,3-dicarboxylic acid |
| Synonym | Source |
|---|---|
| (2R,3S)-1-(phenanthrene-2-carbonyl)piperazine-2,3-dicarboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 9660564 | ChemSpider |
| Citations |
|---|