EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18N2O5 |
| Net Charge | 0 |
| Average Mass | 378.384 |
| Monoisotopic Mass | 378.12157 |
| SMILES | O=C(O)C1NCCN(C(=O)c2ccc3c(ccc4ccccc43)c2)C1C(=O)O |
| InChI | InChI=1S/C21H18N2O5/c24-19(23-10-9-22-17(20(25)26)18(23)21(27)28)14-7-8-16-13(11-14)6-5-12-3-1-2-4-15(12)16/h1-8,11,17-18,22H,9-10H2,(H,25,26)(H,27,28) |
| InChIKey | IWWXIZOMXGOTPP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(phenanthren-2-ylcarbonyl)piperazine-2,3-dicarboxylic acid (CHEBI:189873) is a N-acylpiperazine (CHEBI:46844) |
| 1-(phenanthren-2-ylcarbonyl)piperazine-2,3-dicarboxylic acid (CHEBI:189873) is a dicarboxylic acid (CHEBI:35692) |
| 1-(phenanthren-2-ylcarbonyl)piperazine-2,3-dicarboxylic acid (CHEBI:189873) is a phenanthrenes (CHEBI:25961) |
| 1-(phenanthren-2-ylcarbonyl)piperazine-2,3-dicarboxylic acid (CHEBI:189873) is a tertiary carboxamide (CHEBI:140326) |
| Incoming Relation(s) |
| (2R,3S)-PPDA (CHEBI:189871) is a 1-(phenanthren-2-ylcarbonyl)piperazine-2,3-dicarboxylic acid (CHEBI:189873) |
| (2S,3R)-PPDA (CHEBI:189872) is a 1-(phenanthren-2-ylcarbonyl)piperazine-2,3-dicarboxylic acid (CHEBI:189873) |
| IUPAC Name |
|---|
| 1-(phenanthren-2-ylcarbonyl)piperazine-2,3-dicarboxylic acid |
| Synonym | Source |
|---|---|
| 1-(2-phenanthrenylcarbonyl)-2,3-piperazinedicarboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8468498 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:1202172-03-9 | ChEBI |
| Citations |
|---|