EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26Cl2N4O |
| Net Charge | +2 |
| Average Mass | 409.361 |
| Monoisotopic Mass | 408.14727 |
| SMILES | CC[NH+](CCCl)CCCNc1c2ccc(Cl)cc2nc2ccc(OC)[nH+]c12 |
| InChI | InChI=1S/C20H24Cl2N4O/c1-3-26(12-9-21)11-4-10-23-19-15-6-5-14(22)13-17(15)24-16-7-8-18(27-2)25-20(16)19/h5-8,13H,3-4,9-12H2,1-2H3,(H,23,24)/p+2 |
| InChIKey | RONPMXQSZMYCGD-UHFFFAOYSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ICR 340(2+) (CHEBI:189545) is a ammonium ion derivative (CHEBI:35274) |
| ICR 340(2+) (CHEBI:189545) is conjugate acid of ICR 340 (free base) (CHEBI:189532) |
| Incoming Relation(s) |
| ICR 340 (CHEBI:189531) has part ICR 340(2+) (CHEBI:189545) |
| ICR 340 (free base) (CHEBI:189532) is conjugate base of ICR 340(2+) (CHEBI:189545) |
| IUPAC Name |
|---|
| 7-chloro-10-({3-[(2-chloroethyl)(ethyl)azaniumyl]propyl}amino)-2-methoxybenzo[b][1,5]naphthyridin-1-ium |
| Synonyms | Source |
|---|---|
| ICR-340(2+) | ChEBI |
| ICR 340 dication | ChEBI |
| ICR-340 dication | ChEBI |