EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24Cl2N4O.2HCl |
| Net Charge | 0 |
| Average Mass | 480.267 |
| Monoisotopic Mass | 478.08607 |
| SMILES | CCN(CCCl)CCCNc1c2ccc(Cl)cc2nc2ccc(OC)nc12.Cl.Cl |
| InChI | InChI=1S/C20H24Cl2N4O.2ClH/c1-3-26(12-9-21)11-4-10-23-19-15-6-5-14(22)13-17(15)24-16-7-8-18(27-2)25-20(16)19;;/h5-8,13H,3-4,9-12H2,1-2H3,(H,23,24);2*1H |
| InChIKey | PUURHJFGPZZDJF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ICR 340 (CHEBI:189531) has part ICR 340(2+) (CHEBI:189545) |
| ICR 340 (CHEBI:189531) has role carcinogenic agent (CHEBI:50903) |
| ICR 340 (CHEBI:189531) has role mutagen (CHEBI:25435) |
| ICR 340 (CHEBI:189531) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N-(2-chloroethyl)-N'-(7-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)-N-ethylpropane-1,3-diamine dihydrochloride |
| Synonyms | Source |
|---|---|
| N1-(2-chloroethyl)-N3-(7-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)-N1-ethylpropane-1,3-diamine—hydrogen chloride (1/2) | IUPAC |
| ICR-340 | ChEBI |
| ICR 340 dihydrochloride | ChEBI |
| ICR-340 dihydrochloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4514643 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:38915-28-5 | ChemIDplus |
| Citations |
|---|