EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24Cl2N4O |
| Net Charge | 0 |
| Average Mass | 407.345 |
| Monoisotopic Mass | 406.13272 |
| SMILES | CCN(CCCl)CCCNc1c2ccc(Cl)cc2nc2ccc(OC)nc12 |
| InChI | InChI=1S/C20H24Cl2N4O/c1-3-26(12-9-21)11-4-10-23-19-15-6-5-14(22)13-17(15)24-16-7-8-18(27-2)25-20(16)19/h5-8,13H,3-4,9-12H2,1-2H3,(H,23,24) |
| InChIKey | RONPMXQSZMYCGD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ICR 340 (free base) (CHEBI:189532) is a aromatic ether (CHEBI:35618) |
| ICR 340 (free base) (CHEBI:189532) is a organic heterotricyclic compound (CHEBI:26979) |
| ICR 340 (free base) (CHEBI:189532) is a organochlorine compound (CHEBI:36683) |
| ICR 340 (free base) (CHEBI:189532) is a secondary amino compound (CHEBI:50995) |
| ICR 340 (free base) (CHEBI:189532) is a tertiary amino compound (CHEBI:50996) |
| ICR 340 (free base) (CHEBI:189532) is conjugate base of ICR 340(2+) (CHEBI:189545) |
| Incoming Relation(s) |
| ICR 340(2+) (CHEBI:189545) is conjugate acid of ICR 340 (free base) (CHEBI:189532) |
| IUPAC Name |
|---|
| N-(2-chloroethyl)-N'-(7-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)-N-ethylpropane-1,3-diamine |
| Synonym | Source |
|---|---|
| ICR-340 (free base) | ChEBI |