EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29NO4 |
| Net Charge | 0 |
| Average Mass | 323.433 |
| Monoisotopic Mass | 323.20966 |
| SMILES | CC/C=C\C[C@@H]1C(=O)CC[C@@H]1CC(=O)N[C@H](C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C18H29NO4/c1-4-6-7-8-14-13(9-10-15(14)20)11-16(21)19-17(18(22)23)12(3)5-2/h6-7,12-14,17H,4-5,8-11H2,1-3H3,(H,19,21)(H,22,23)/b7-6-/t12-,13+,14-,17-/m0/s1 |
| InChIKey | IBZYPBGPOGJMBF-QPERPISQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | - | PubMed (20012084) | |
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (19349968) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(+)-7-isojasmonyl]-L-isoleucine (CHEBI:137043) has functional parent (+)-7-isojasmonic acid (CHEBI:18435) |
| N-[(+)-7-isojasmonyl]-L-isoleucine (CHEBI:137043) has role jasmonates (CHEBI:24937) |
| N-[(+)-7-isojasmonyl]-L-isoleucine (CHEBI:137043) has role plant metabolite (CHEBI:76924) |
| N-[(+)-7-isojasmonyl]-L-isoleucine (CHEBI:137043) is a N-acyl-L-α-amino acid (CHEBI:48927) |
| N-[(+)-7-isojasmonyl]-L-isoleucine (CHEBI:137043) is a L-isoleucine derivative (CHEBI:84111) |
| N-[(+)-7-isojasmonyl]-L-isoleucine (CHEBI:137043) is a fatty amide (CHEBI:29348) |
| N-[(+)-7-isojasmonyl]-L-isoleucine (CHEBI:137043) is conjugate acid of N-[(+)-7-isojasmonyl]-L-isoleucinate (CHEBI:136180) |
| Incoming Relation(s) |
| N-[(+)-7-isojasmonyl]-L-isoleucinate (CHEBI:136180) is conjugate base of N-[(+)-7-isojasmonyl]-L-isoleucine (CHEBI:137043) |
| IUPAC Name |
|---|
| N-({(R,2S)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetyl)-L-isoleucine |
| Synonyms | Source |
|---|---|
| (3R,7S)-JA-L-Ile | MetaCyc |
| (+)-7-iso-JA-L-Ile | MetaCyc |
| (+)-7-isojasmonyl-L-isoleucine | MetaCyc |
| (+)-7-isojasmonic acid-L-isoleucine conjugate | MetaCyc |
| N-[(+)-7-isojasmonyl]isoleucine | ChEBI |
| (+)-7-iso-JA-Ile | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-11259 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18883677 | Reaxys |
| Citations |
|---|