EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO3 |
| Net Charge | 0 |
| Average Mass | 169.180 |
| Monoisotopic Mass | 169.07389 |
| SMILES | NC[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/t8-/m0/s1 |
| InChIKey | SFLSHLFXELFNJZ-QMMMGPOBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Applications: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. vasoconstrictor agent Drug used to cause constriction of the blood vessels. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-noradrenaline (CHEBI:18357) has role mouse metabolite (CHEBI:75771) |
| (R)-noradrenaline (CHEBI:18357) has role neurotransmitter (CHEBI:25512) |
| (R)-noradrenaline (CHEBI:18357) has role sympathomimetic agent (CHEBI:35524) |
| (R)-noradrenaline (CHEBI:18357) has role vasoconstrictor agent (CHEBI:50514) |
| (R)-noradrenaline (CHEBI:18357) has role α-adrenergic agonist (CHEBI:35569) |
| (R)-noradrenaline (CHEBI:18357) is a noradrenaline (CHEBI:33569) |
| (R)-noradrenaline (CHEBI:18357) is conjugate base of (R)-noradrenaline(1+) (CHEBI:72587) |
| (R)-noradrenaline (CHEBI:18357) is enantiomer of (S)-noradrenaline (CHEBI:33571) |
| Incoming Relation(s) |
| N-[(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-L-glutamine residue (CHEBI:167178) has functional parent (R)-noradrenaline (CHEBI:18357) |
| (R)-noradrenaline(1+) (CHEBI:72587) is conjugate acid of (R)-noradrenaline (CHEBI:18357) |
| (S)-noradrenaline (CHEBI:33571) is enantiomer of (R)-noradrenaline (CHEBI:18357) |
| IUPAC Name |
|---|
| 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol |
| INNs | Source |
|---|---|
| norepinefrina | ChEBI |
| norepinephrine | ChemIDplus |
| norépinéphrine | WHO MedNet |
| norepinephrinum | ChEBI |
| Synonyms | Source |
|---|---|
| 4-[(1R)-2-Amino-1-hydroxyethyl]-1,2-benzenediol | KEGG COMPOUND |
| (−)-arterenol | ChemIDplus |
| Arterenol | KEGG COMPOUND |
| (R)-4-(2-amino-1-hydroxyethyl)-1,2-benzenediol | ChemIDplus |
| (R)-(−)-norepinephrine | ChemIDplus |
| (R)-norepinephrine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1960 | DrugCentral |
| C00001424 | KNApSAcK |
| C00547 | KEGG COMPOUND |
| C00547 | KEGG COMPOUND |
| D00076 | KEGG DRUG |
| DB00368 | DrugBank |
| HMDB0000216 | HMDB |
| LNR | PDBeChem |
| Norepinephrine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2804840 | Reaxys |
| Beilstein:4231961 | Beilstein |
| CAS:51-41-2 | KEGG COMPOUND |
| CAS:51-41-2 | ChemIDplus |