EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO3 |
| Net Charge | 0 |
| Average Mass | 169.180 |
| Monoisotopic Mass | 169.07389 |
| SMILES | NCC(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2 |
| InChIKey | SFLSHLFXELFNJZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| noradrenaline (CHEBI:33569) has role human xenobiotic metabolite (CHEBI:76967) |
| noradrenaline (CHEBI:33569) is a catecholamine (CHEBI:33567) |
| noradrenaline (CHEBI:33569) is conjugate base of noradrenaline(1+) (CHEBI:166902) |
| Incoming Relation(s) |
| (R)-noradrenaline (CHEBI:18357) is a noradrenaline (CHEBI:33569) |
| (S)-noradrenaline (CHEBI:33571) is a noradrenaline (CHEBI:33569) |
| noradrenaline(1+) (CHEBI:166902) is conjugate acid of noradrenaline (CHEBI:33569) |
| IUPAC Name |
|---|
| 4-(2-amino-1-hydroxyethyl)benzene-1,2-diol |
| Synonyms | Source |
|---|---|
| norepinephrine | ChEBI |
| noradrenalina | ChEBI |