EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O4 |
| Net Charge | 0 |
| Average Mass | 306.402 |
| Monoisotopic Mass | 306.18311 |
| SMILES | COc1cc(COC(=O)CCCC/C=C/C(C)C)ccc1O |
| InChI | InChI=1S/C18H26O4/c1-14(2)8-6-4-5-7-9-18(20)22-13-15-10-11-16(19)17(12-15)21-3/h6,8,10-12,14,19H,4-5,7,9,13H2,1-3H3/b8-6+ |
| InChIKey | ZICNYIDDNJYKCP-SOFGYWHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Capsicum annuum (ncbitaxon:4072) | - | PubMed (21883144) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. capsaicin receptor agonist An agonist that binds to and activates capsaicin receptors |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. anti-allergic agent A drug used to treat allergic reactions. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capsiate (CHEBI:134190) has functional parent vanillyl alcohol (CHEBI:18353) |
| capsiate (CHEBI:134190) has role angiogenesis inhibitor (CHEBI:48422) |
| capsiate (CHEBI:134190) has role anti-allergic agent (CHEBI:50857) |
| capsiate (CHEBI:134190) has role anti-inflammatory agent (CHEBI:67079) |
| capsiate (CHEBI:134190) has role antioxidant (CHEBI:22586) |
| capsiate (CHEBI:134190) has role capsaicin receptor agonist (CHEBI:137401) |
| capsiate (CHEBI:134190) has role hypoglycemic agent (CHEBI:35526) |
| capsiate (CHEBI:134190) has role plant metabolite (CHEBI:76924) |
| capsiate (CHEBI:134190) is a carboxylic ester (CHEBI:33308) |
| capsiate (CHEBI:134190) is a monomethoxybenzene (CHEBI:25235) |
| capsiate (CHEBI:134190) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (4-hydroxy-3-methoxyphenyl)methyl (6E)-8-methylnon-6-enoate |
| Synonym | Source |
|---|---|
| vanillyl (6E)-8-methylnon-6-enoate | ChEBI |
| UniProt Name | Source |
|---|---|
| capsiate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 8015237 | ChemSpider |
| C20203 | KEGG COMPOUND |
| HMDB0034780 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7933697 | Reaxys |
| CAS:205687-01-0 | ChemIDplus |
| CAS:205687-01-0 | KEGG COMPOUND |
| Citations |
|---|