EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO3 |
| Net Charge | 0 |
| Average Mass | 129.115 |
| Monoisotopic Mass | 129.04259 |
| SMILES | O=C1CC[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m0/s1 |
| InChIKey | ODHCTXKNWHHXJC-VKHMYHEASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-oxo-L-proline (CHEBI:18183) has role algal metabolite (CHEBI:84735) |
| 5-oxo-L-proline (CHEBI:18183) is a L-proline derivative (CHEBI:84186) |
| 5-oxo-L-proline (CHEBI:18183) is a 5-oxoproline (CHEBI:16010) |
| 5-oxo-L-proline (CHEBI:18183) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 5-oxo-L-proline (CHEBI:18183) is conjugate acid of 5-oxo-L-prolinate (CHEBI:58402) |
| 5-oxo-L-proline (CHEBI:18183) is enantiomer of 5-oxo-D-proline (CHEBI:16924) |
| Incoming Relation(s) |
| pyroglutamylglycine (CHEBI:83067) has functional parent 5-oxo-L-proline (CHEBI:18183) |
| pyroglutamylvaline (CHEBI:132991) has functional parent 5-oxo-L-proline (CHEBI:18183) |
| 5-oxo-L-prolinate (CHEBI:58402) is conjugate base of 5-oxo-L-proline (CHEBI:18183) |
| 5-oxo-D-proline (CHEBI:16924) is enantiomer of 5-oxo-L-proline (CHEBI:18183) |
| 5-oxo-L-proline residue (CHEBI:30652) is substituent group from 5-oxo-L-proline (CHEBI:18183) |
| N-terminal 5-oxo-L-proline residue (CHEBI:87215) is substituent group from 5-oxo-L-proline (CHEBI:18183) |
| IUPAC Names |
|---|
| (2S)-5-oxopyrrolidine-2-carboxylic acid |
| 5-oxo-L-proline |
| INNs | Source |
|---|---|
| acide pidolique | WHO MedNet |
| acido pidolico | WHO MedNet |
| Synonyms | Source |
|---|---|
| (−)-2-pyrrolidone-5-carboxylic acid | ChemIDplus |
| 5-l-oxoproline | ChEMBL |
| 5-Oxo-L-proline | KEGG COMPOUND |
| 5-Oxo-L-proline | KEGG COMPOUND |
| 5-Pyrrolidone-2-carboxylic acid | KEGG COMPOUND |
| Ajidew a-100 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 5-OXOPROLINE | MetaCyc |
| C00007403 | KNApSAcK |
| C01879 | KEGG COMPOUND |
| DB03088 | DrugBank |
| HMDB0000267 | HMDB |
| PCA | PDBeChem |
| Pyroglutamic_acid | Wikipedia |
| YMDB00107 | YMDB |
| Citations |
|---|