EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO3 |
| Net Charge | 0 |
| Average Mass | 129.115 |
| Monoisotopic Mass | 129.04259 |
| SMILES | O=C1CC[C@H](C(=O)O)N1 |
| InChI | InChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m1/s1 |
| InChIKey | ODHCTXKNWHHXJC-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-oxo-D-proline (CHEBI:16924) has role metabolite (CHEBI:25212) |
| 5-oxo-D-proline (CHEBI:16924) is a D-proline derivative (CHEBI:84185) |
| 5-oxo-D-proline (CHEBI:16924) is a 5-oxoproline (CHEBI:16010) |
| 5-oxo-D-proline (CHEBI:16924) is conjugate acid of 5-oxo-D-prolinate (CHEBI:57948) |
| 5-oxo-D-proline (CHEBI:16924) is enantiomer of 5-oxo-L-proline (CHEBI:18183) |
| Incoming Relation(s) |
| 5-oxo-D-prolinate (CHEBI:57948) is conjugate base of 5-oxo-D-proline (CHEBI:16924) |
| 5-oxo-L-proline (CHEBI:18183) is enantiomer of 5-oxo-D-proline (CHEBI:16924) |
| IUPAC Names |
|---|
| (2R)-5-oxopyrrolidine-2-carboxylic acid |
| 5-oxo-D-proline |
| Synonyms | Source |
|---|---|
| 5-Oxo-D-proline | KEGG COMPOUND |
| D-5-Pyrrolidone-2-carboxylic acid | KEGG COMPOUND |
| D-Pyroglutamic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02237 | KEGG COMPOUND |
| CPD-656 | MetaCyc |
| DB03088 | DrugBank |
| HMDB0000267 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1473408 | Gmelin |
| Reaxys:82133 | Reaxys |
| CAS:4042-36-8 | KEGG COMPOUND |
| CAS:4042-36-8 | ChemIDplus |
| Citations |
|---|