EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O4 |
| Net Charge | 0 |
| Average Mass | 228.248 |
| Monoisotopic Mass | 228.11101 |
| SMILES | CC(C)[C@H](NC(=O)[C@@H]1CCC(=O)N1)C(=O)O |
| InChI | InChI=1S/C10H16N2O4/c1-5(2)8(10(15)16)12-9(14)6-3-4-7(13)11-6/h5-6,8H,3-4H2,1-2H3,(H,11,13)(H,12,14)(H,15,16)/t6-,8-/m0/s1 |
| InChIKey | DTSWLLBBGHRXQH-XPUUQOCRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyroglutamylvaline (CHEBI:132991) has functional parent L-valine (CHEBI:16414) |
| pyroglutamylvaline (CHEBI:132991) has functional parent 5-oxo-L-proline (CHEBI:18183) |
| pyroglutamylvaline (CHEBI:132991) is a dipeptide (CHEBI:46761) |
| pyroglutamylvaline (CHEBI:132991) is conjugate acid of pyroglutamylvalinate (CHEBI:132993) |
| Incoming Relation(s) |
| pyroglutamylvalinate (CHEBI:132993) is conjugate base of pyroglutamylvaline (CHEBI:132991) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-valine |
| Synonyms | Source |
|---|---|
| p-Glu-Val | ChEBI |
| 5-oxoprolylvaline | ChEBI |
| Pyro-glu-val | ChemIDplus |
| Pyroglutamyl valine | ChemIDplus |
| L-pyroglutamyl-L-valine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26522098 | Reaxys |
| CAS:21282-10-0 | ChemIDplus |