EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H9N |
| Net Charge | 0 |
| Average Mass | 59.112 |
| Monoisotopic Mass | 59.07350 |
| SMILES | CN(C)C |
| InChI | InChI=1S/C3H9N/c1-4(2)3/h1-3H3 |
| InChIKey | GETQZCLCWQTVFV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimethylamine (CHEBI:18139) has role Escherichia coli metabolite (CHEBI:76971) |
| trimethylamine (CHEBI:18139) has role human xenobiotic metabolite (CHEBI:76967) |
| trimethylamine (CHEBI:18139) is a methylamines (CHEBI:25274) |
| trimethylamine (CHEBI:18139) is a tertiary amine (CHEBI:32876) |
| trimethylamine (CHEBI:18139) is conjugate base of trimethylammonium (CHEBI:58389) |
| Incoming Relation(s) |
| trimethylamine N-oxide (CHEBI:15724) has functional parent trimethylamine (CHEBI:18139) |
| trimethylammonium (CHEBI:58389) is conjugate acid of trimethylamine (CHEBI:18139) |
| IUPAC Name |
|---|
| N,N-dimethylmethanamine |
| Synonyms | Source |
|---|---|
| (CH3)3N | KEGG COMPOUND |
| N,N,N-trimethylamine | ChEBI |
| N(CH3)3 | ChEBI |
| NMe3 | ChEBI |
| N,N-Dimethylmethanamine | KEGG COMPOUND |
| TMA | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C00001433 | KNApSAcK |
| C00565 | KEGG COMPOUND |
| HMDB0000906 | HMDB |
| KEN | PDBeChem |
| Trimethylamine | Wikipedia |
| TRIMETHYLAMINE | MetaCyc |
| Citations |
|---|