EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H10N |
| Net Charge | +1 |
| Average Mass | 60.120 |
| Monoisotopic Mass | 60.08078 |
| SMILES | C[NH+](C)C |
| InChI | InChI=1S/C3H9N/c1-4(2)3/h1-3H3/p+1 |
| InChIKey | GETQZCLCWQTVFV-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimethylammonium (CHEBI:58389) has role human xenobiotic metabolite (CHEBI:76967) |
| trimethylammonium (CHEBI:58389) is a ammonium ion derivative (CHEBI:35274) |
| trimethylammonium (CHEBI:58389) is conjugate acid of trimethylamine (CHEBI:18139) |
| Incoming Relation(s) |
| hydroxytrimethylaminium (CHEBI:166856) has functional parent trimethylammonium (CHEBI:58389) |
| trimethylamine hydrochloride (CHEBI:64700) has part trimethylammonium (CHEBI:58389) |
| trimethylamine (CHEBI:18139) is conjugate base of trimethylammonium (CHEBI:58389) |
| trimethylammonio group (CHEBI:176790) is substituent group from trimethylammonium (CHEBI:58389) |
| IUPAC Name |
|---|
| N,N-dimethylmethanaminium |
| Synonyms | Source |
|---|---|
| trimethylammonium cation | ChEBI |
| trimethylazanium | ChEBI |
| trimethylazanium cation | ChEBI |
| UniProt Name | Source |
|---|---|
| trimethylamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| TRIMETHYLAMINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:16709444 | Reaxys |