EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4N4O4 |
| Net Charge | 0 |
| Average Mass | 184.111 |
| Monoisotopic Mass | 184.02325 |
| SMILES | O=C1N=C2NC(=O)NC2(O)C(=O)N1 |
| InChI | InChI=1S/C5H4N4O4/c10-2-5(13)1(6-3(11)8-2)7-4(12)9-5/h13H,(H3,6,7,8,9,10,11,12) |
| InChIKey | LTQYPAVLAYVKTK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyisouric acid (CHEBI:18072) has functional parent 5,7-dihydro-1H-purine-2,6,8(9H)-trione (CHEBI:49051) |
| 5-hydroxyisouric acid (CHEBI:18072) has role human metabolite (CHEBI:77746) |
| 5-hydroxyisouric acid (CHEBI:18072) has role mouse metabolite (CHEBI:75771) |
| 5-hydroxyisouric acid (CHEBI:18072) is a oxopurine (CHEBI:25810) |
| 5-hydroxyisouric acid (CHEBI:18072) is conjugate acid of 5-hydroxyisouric acid anion (CHEBI:59562) |
| Incoming Relation(s) |
| 1,3,7-trimethyl-5-hydroxyisouric acid (CHEBI:90885) has functional parent 5-hydroxyisouric acid (CHEBI:18072) |
| 5-hydroxyisouric acid anion (CHEBI:59562) is conjugate base of 5-hydroxyisouric acid (CHEBI:18072) |
| IUPAC Name |
|---|
| 5-hydroxy-5,7-dihydro-1H-purine-2,6,8(9H)-trione |
| Synonym | Source |
|---|---|
| 5-Hydroxyisourate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 5-hydroxyisourate | UniProt |