EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N4O4 |
| Net Charge | 0 |
| Average Mass | 226.192 |
| Monoisotopic Mass | 226.07020 |
| SMILES | CN1C(=O)N(C)C2=NC(=O)N(C)C2(O)C1=O |
| InChI | InChI=1S/C8H10N4O4/c1-10-4-8(16,12(3)6(14)9-4)5(13)11(2)7(10)15/h16H,1-3H3 |
| InChIKey | XNXQVRHXDIDGDT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas sp. (ncbitaxon:306) | - | PubMed (22609920) | Strain: CBB1 |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,7-trimethyl-5-hydroxyisouric acid (CHEBI:90885) has functional parent 5-hydroxyisouric acid (CHEBI:18072) |
| 1,3,7-trimethyl-5-hydroxyisouric acid (CHEBI:90885) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 1,3,7-trimethyl-5-hydroxyisouric acid (CHEBI:90885) is a oxopurine (CHEBI:25810) |
| IUPAC Name |
|---|
| 5-hydroxy-1,3,7-trimethyl-5,7-dihydro-1H-purine-2,6,8(3H)-trione |
| UniProt Name | Source |
|---|---|
| 1,3,7-trimethyl-5-hydroxyisourate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16697 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8262001 | Reaxys |
| Citations |
|---|