EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H3N4O4 |
| Net Charge | -1 |
| Average Mass | 183.103 |
| Monoisotopic Mass | 183.01598 |
| SMILES | O=C1N=C2N=C([O-])NC2(O)C(=O)N1 |
| InChI | InChI=1S/C5H4N4O4/c10-2-5(13)1(6-3(11)8-2)7-4(12)9-5/h13H,(H3,6,7,8,9,10,11,12)/p-1 |
| InChIKey | LTQYPAVLAYVKTK-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyisouric acid anion (CHEBI:59562) is a oxopurine (CHEBI:25810) |
| 5-hydroxyisouric acid anion (CHEBI:59562) is a urate(1−) (CHEBI:30848) |
| 5-hydroxyisouric acid anion (CHEBI:59562) is conjugate base of 5-hydroxyisouric acid (CHEBI:18072) |
| Incoming Relation(s) |
| 5-hydroxyisouric acid (CHEBI:18072) is conjugate acid of 5-hydroxyisouric acid anion (CHEBI:59562) |
| IUPAC Name |
|---|
| 5-hydroxy-2,6-dioxo-2,5,6,7-tetrahydro-1H-purin-8-olate |
| Synonyms | Source |
|---|---|
| 5-hydroxy-2,6-dioxo-2,5,6,7-tetrahydro-1H-purin-8-ol anion | ChEBI |
| 5-hydroxyisourate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7818573 | Beilstein |
| Citations |
|---|