EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18ClNS.HCl |
| Net Charge | 0 |
| Average Mass | 352.330 |
| Monoisotopic Mass | 351.06153 |
| SMILES | Cl.[H]C(CCN(C)C)=C1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H18ClNS.ClH/c1-20(2)11-5-7-14-15-6-3-4-8-17(15)21-18-10-9-13(19)12-16(14)18;/h3-4,6-10,12H,5,11H2,1-2H3;1H |
| InChIKey | YWKRLOSRDGPEJR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. first generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be more likely than second generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements; such body movements can become permanent even after treatment has ceased. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorprothixene hydrochloride (CHEBI:180502) has part chlorprothixene(1+) (CHEBI:180503) |
| chlorprothixene hydrochloride (CHEBI:180502) has role antiemetic (CHEBI:50919) |
| chlorprothixene hydrochloride (CHEBI:180502) has role cholinergic antagonist (CHEBI:48873) |
| chlorprothixene hydrochloride (CHEBI:180502) has role dopaminergic antagonist (CHEBI:48561) |
| chlorprothixene hydrochloride (CHEBI:180502) has role first generation antipsychotic (CHEBI:65190) |
| chlorprothixene hydrochloride (CHEBI:180502) has role geroprotector (CHEBI:176497) |
| chlorprothixene hydrochloride (CHEBI:180502) has role non-narcotic analgesic (CHEBI:35481) |
| chlorprothixene hydrochloride (CHEBI:180502) has role sedative (CHEBI:35717) |
| chlorprothixene hydrochloride (CHEBI:180502) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine hydrochloride |
| Synonyms | Source |
|---|---|
| 3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine—hydrogen chloride | IUPAC |
| 3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethylpropan-1-aminium chloride | IUPAC |
| 2-chloro-9-(3-dimethylaminopropylidene)thioxanthene hydrochloride | ChEBI |
| chlorprothixene HCl | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 20479320 | ChemSpider |
| DBSALT002973 | DrugBank |
| Citations |
|---|