EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO5 |
| Net Charge | 0 |
| Average Mass | 211.173 |
| Monoisotopic Mass | 211.04807 |
| SMILES | COc1ccc2c(c1)OC(O)C(=O)N2O |
| InChI | InChI=1S/C9H9NO5/c1-14-5-2-3-6-7(4-5)15-9(12)8(11)10(6)13/h2-4,9,12-13H,1H3 |
| InChIKey | GDNZNIJPBQATCZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DIMBOA (CHEBI:18048) has functional parent DIBOA (CHEBI:63558) |
| DIMBOA (CHEBI:18048) has role allelochemical (CHEBI:62215) |
| DIMBOA (CHEBI:18048) has role plant metabolite (CHEBI:76924) |
| DIMBOA (CHEBI:18048) is a aromatic ether (CHEBI:35618) |
| DIMBOA (CHEBI:18048) is a benzoxazine (CHEBI:46969) |
| DIMBOA (CHEBI:18048) is a cyclic hydroxamic acid (CHEBI:23445) |
| DIMBOA (CHEBI:18048) is a lactol (CHEBI:38131) |
| Incoming Relation(s) |
| DIMBOA glucoside (CHEBI:16603) has functional parent DIMBOA (CHEBI:18048) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-7-methoxy-2H-1,4-benzoxazin-3(4H)-one |
| Synonyms | Source |
|---|---|
| 2,4-Dihydroxy-7-methoxy-2H-1,4-benzoxazin-3(4H)-one | KEGG COMPOUND |
| 2,4-Dihydroxy-7-methoxy-1,4-benzoxazin-3-one | ChemIDplus |
| 2,4-Dihydroxy-7-methoxy-2H-1,4-benzoxazin-3(4H)-one | KEGG COMPOUND |
| 2,4-Dihydroxy-7-methoxy-1,4-benzoxazin-3-one | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| DIMBOA | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C04720 | KEGG COMPOUND |
| DIMBOA | Wikipedia |
| HMDB0034864 | HMDB |
| C00026498 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1078658 | Reaxys |
| CAS:15893-52-4 | ChemIDplus |
| CAS:15893-52-4 | KEGG COMPOUND |
| Citations |
|---|