EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7NO4 |
| Net Charge | 0 |
| Average Mass | 181.147 |
| Monoisotopic Mass | 181.03751 |
| SMILES | O=C1C(O)Oc2ccccc2N1O |
| InChI | InChI=1S/C8H7NO4/c10-7-8(11)13-6-4-2-1-3-5(6)9(7)12/h1-4,8,11-12H |
| InChIKey | COVOPZQGJGUPEY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aphelandra tetragona (ncbitaxon:328118) | root (BTO:0001188) | PubMed (10680174) |
| Roles Classification |
|---|
| Biological Roles: | phytotoxin Any toxin produced by a plant. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DIBOA (CHEBI:63558) has role allelochemical (CHEBI:62215) |
| DIBOA (CHEBI:63558) has role herbicide (CHEBI:24527) |
| DIBOA (CHEBI:63558) has role phytotoxin (CHEBI:38231) |
| DIBOA (CHEBI:63558) has role plant metabolite (CHEBI:76924) |
| DIBOA (CHEBI:63558) is a benzoxazine (CHEBI:46969) |
| DIBOA (CHEBI:63558) is a cyclic hydroxamic acid (CHEBI:23445) |
| DIBOA (CHEBI:63558) is a lactol (CHEBI:38131) |
| Incoming Relation(s) |
| DIBOA β-D-glucoside (CHEBI:63670) has functional parent DIBOA (CHEBI:63558) |
| DIMBOA (CHEBI:18048) has functional parent DIBOA (CHEBI:63558) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-2H-1,4-benzoxazin-3(4H)-one |
| Synonyms | Source |
|---|---|
| 2,4-Dihydroxy-1,4-benzoxazin-3-one | KEGG COMPOUND |
| 2,4-Dihydroxy-1,4-benzoxazinone | ChemIDplus |
| 2,4-Dihydroxy-2H-1,4-benzoxazin-3(4H)-one | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| DIBOA | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00036460 | KNApSAcK |
| C15770 | KEGG COMPOUND |
| CPD-6365 | MetaCyc |
| FDB011857 | FooDB |
| HMDB0033733 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1077308 | Reaxys |
| CAS:17359-54-5 | ChemIDplus |
| CAS:17359-54-5 | KEGG COMPOUND |
| Citations |
|---|