EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO10 |
| Net Charge | 0 |
| Average Mass | 373.314 |
| Monoisotopic Mass | 373.10090 |
| SMILES | COc1ccc2c(c1)OC(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(=O)N2O |
| InChI | InChI=1S/C15H19NO10/c1-23-6-2-3-7-8(4-6)24-15(13(21)16(7)22)26-14-12(20)11(19)10(18)9(5-17)25-14/h2-4,9-12,14-15,17-20,22H,5H2,1H3/t9-,10-,11+,12-,14+,15?/m1/s1 |
| InChIKey | WTGXAWKVZMQEDA-XGHDNVSXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Triticum aestivum (ncbitaxon:4565) | - | PubMed (24254087) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DIMBOA glucoside (CHEBI:16603) has functional parent DIMBOA (CHEBI:18048) |
| DIMBOA glucoside (CHEBI:16603) has role plant metabolite (CHEBI:76924) |
| DIMBOA glucoside (CHEBI:16603) is a benzoxazine (CHEBI:46969) |
| DIMBOA glucoside (CHEBI:16603) is a cyclic hydroxamic acid (CHEBI:23445) |
| DIMBOA glucoside (CHEBI:16603) is a β-D-glucoside (CHEBI:22798) |
| Incoming Relation(s) |
| (2R)-DIMBOA glucoside (CHEBI:37573) is a DIMBOA glucoside (CHEBI:16603) |
| IUPAC Name |
|---|
| 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2,4-Dihydroxy-7-methoxy-1,4-benzoxazin-3-one glucoside | KEGG COMPOUND |
| 2,4-Dihydroxy-7-methoxy-2H-1,4-benzoxazin-3(4H)-one 2-D-glucoside | KEGG COMPOUND |
| 2,4-Dihydroxy-7-methoxy-2H-1,4-benzoxazin-3(4H)-one 2-D-glucoside | KEGG COMPOUND |
| DIMBOA glucoside | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| DIMBOA glucoside | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00001538 | KNApSAcK |
| C04831 | KEGG COMPOUND |
| HMDB0029710 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1230506 | Reaxys |
| CAS:18607-79-9 | KEGG COMPOUND |
| Citations |
|---|