EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O2 |
| Net Charge | 0 |
| Average Mass | 142.198 |
| Monoisotopic Mass | 142.09938 |
| SMILES | [H]C(C)=C([H])C(C)C(=O)OCC |
| InChI | InChI=1S/C8H14O2/c1-4-6-7(3)8(9)10-5-2/h4,6-7H,5H2,1-3H3 |
| InChIKey | HOWBPXBYCPKWBL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 2-methyl-3-pentenoate (CHEBI:180294) has functional parent 2-Methyl-3-pentenoic acid (CHEBI:173389) |
| ethyl 2-methyl-3-pentenoate (CHEBI:180294) has role flavouring agent (CHEBI:35617) |
| ethyl 2-methyl-3-pentenoate (CHEBI:180294) is a fatty acid ethyl ester (CHEBI:78206) |
| Incoming Relation(s) |
| (3E)-ethyl 2-methyl-3-pentenoate (CHEBI:189083) is a ethyl 2-methyl-3-pentenoate (CHEBI:180294) |
| (3Z)-ethyl 2-methyl-3-pentenoate (CHEBI:189084) is a ethyl 2-methyl-3-pentenoate (CHEBI:180294) |
| IUPAC Name |
|---|
| ethyl 2-methylpent-3-enoate |
| Synonyms | Source |
|---|---|
| 2-methyl-3-pentenoic acid ethyl ester | ChemIDplus |
| ethyl 2-methylpent-3-en-1-oate | ChemIDplus |
| FEMA 3456 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 21105891 | ChemSpider |
| FDB016736 | FooDB |
| HMDB0037622 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1853113 | Reaxys |
| CAS:1617-23-8 | ChemIDplus |
| Citations |
|---|