EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O2 |
| Net Charge | 0 |
| Average Mass | 114.144 |
| Monoisotopic Mass | 114.06808 |
| SMILES | C/C=C/C(C)C(=O)O |
| InChI | InChI=1S/C6H10O2/c1-3-4-5(2)6(7)8/h3-5H,1-2H3,(H,7,8)/b4-3+ |
| InChIKey | NFRJJFMXYKSRPK-ONEGZZNKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Methyl-3-pentenoic acid (CHEBI:173389) is a methyl-branched fatty acid (CHEBI:62499) |
| Incoming Relation(s) |
| ethyl 2-methyl-3-pentenoate (CHEBI:180294) has functional parent 2-Methyl-3-pentenoic acid (CHEBI:173389) |
| IUPAC Name |
|---|
| (E)-2-methylpent-3-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4940555 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:37674-63-8 | ChemIDplus |