EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O2 |
| Net Charge | 0 |
| Average Mass | 142.198 |
| Monoisotopic Mass | 142.09938 |
| SMILES | C/C=C/C(C)C(=O)OCC |
| InChI | InChI=1S/C8H14O2/c1-4-6-7(3)8(9)10-5-2/h4,6-7H,5H2,1-3H3/b6-4+ |
| InChIKey | HOWBPXBYCPKWBL-GQCTYLIASA-N |
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3E)-ethyl 2-methyl-3-pentenoate (CHEBI:189083) is a ethyl 2-methyl-3-pentenoate (CHEBI:180294) |
| IUPAC Name |
|---|
| ethyl (3E)-2-methylpent-3-enoate |
| Synonyms | Source |
|---|---|
| (3E)-2-methyl-3-pentenoic acid ethyl ester | ChemIDplus |
| ethyl (E)-2-methylpent-3-enoate | ChemIDplus |
| (E)-2-methyl-3-pentenoic acid ethyl ester | ChemIDplus |
| (E)-ethyl 2-methyl-3-pentenoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4576405 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2039033 | Reaxys |
| CAS:16489-03-5 | ChemIDplus |