EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N7O17P3 |
| Net Charge | -3 |
| Average Mass | 740.385 |
| Monoisotopic Mass | 740.05362 |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](OP(=O)([O-])[O-])[C@@H]3O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C21H28N7O17P3/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(44-46(33,34)35)14(30)11(43-21)6-41-48(38,39)45-47(36,37)40-5-10-13(29)15(31)20(42-10)27-3-1-2-9(4-27)18(23)32/h1-4,7-8,10-11,13-16,20-21,29-31H,5-6H2,(H7-,22,23,24,25,32,33,34,35,36,37,38,39)/p-3/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1 |
| InChIKey | XJLXINKUBYWONI-NNYOXOHSSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | electron acceptor A substance to which an electron may be transferred. |
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NADP(3−) (CHEBI:58349) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| NADP(3−) (CHEBI:58349) has role cofactor (CHEBI:23357) |
| NADP(3−) (CHEBI:58349) has role human metabolite (CHEBI:77746) |
| NADP(3−) (CHEBI:58349) is a hydrogen acceptor (CHEBI:13193) |
| NADP(3−) (CHEBI:58349) is a organophosphate oxoanion (CHEBI:58945) |
| NADP(3−) (CHEBI:58349) is conjugate base of NADP+ (CHEBI:18009) |
| Incoming Relation(s) |
| NADP+ (CHEBI:18009) is conjugate acid of NADP(3−) (CHEBI:58349) |
| IUPAC Name |
|---|
| 2'-O-phosphonatoadenosine 5'-{3-[1-(3-carbamoylpyridinio)-1,4-anhydro-D-ribitol-5-yl] diphosphate} |
| Synonym | Source |
|---|---|
| NADP trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| NADP+ | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4122171 | Reaxys |