EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O2 |
| Net Charge | 0 |
| Average Mass | 400.647 |
| Monoisotopic Mass | 400.33413 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C27H44O2/c1-19-10-13-23(28)18-22(19)12-11-21-9-7-17-27(5)24(14-15-25(21)27)20(2)8-6-16-26(3,4)29/h11-12,20,23-25,28-29H,1,6-10,13-18H2,2-5H3/b21-11+,22-12-/t20-,23+,24-,25+,27-/m1/s1 |
| InChIKey | JWUBBDSIWDLEOM-DTOXIADCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Applications: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcidiol (CHEBI:17933) has role bone density conservation agent (CHEBI:50646) |
| calcidiol (CHEBI:17933) has role human metabolite (CHEBI:77746) |
| calcidiol (CHEBI:17933) has role metabolite (CHEBI:25212) |
| calcidiol (CHEBI:17933) has role mouse metabolite (CHEBI:75771) |
| calcidiol (CHEBI:17933) has role nutraceutical (CHEBI:50733) |
| calcidiol (CHEBI:17933) is a D3 vitamins (CHEBI:73558) |
| calcidiol (CHEBI:17933) is a diol (CHEBI:23824) |
| calcidiol (CHEBI:17933) is a hydroxycalciol (CHEBI:47042) |
| Incoming Relation(s) |
| calcidiol 25-O-(β-D-glucuronate) (CHEBI:139277) has functional parent calcidiol (CHEBI:17933) |
| calcidiol 25-O-(β-D-glucuronide) (CHEBI:139610) has functional parent calcidiol (CHEBI:17933) |
| calcidiol 3-O-(β-D-glucuronate) (CHEBI:139278) has functional parent calcidiol (CHEBI:17933) |
| calcidiol 3-O-(β-D-glucuronide) (CHEBI:139613) has functional parent calcidiol (CHEBI:17933) |
| IUPAC Name |
|---|
| (3S,5Z,7E)-9,10-secocholesta-5,7,10(19)-triene-3,25-diol |
| INNs | Source |
|---|---|
| calcifediol | WHO MedNet |
| calcifediol | ChEBI |
| calcifédiol | ChEBI |
| calcifediolum | ChEBI |
| Synonyms | Source |
|---|---|
| 25-hydroxycholecalciferol | JCBN |
| 25-Hydroxyvitamin D3 | KEGG COMPOUND |
| 25-hydroxyvitamin D3 | ChEBI |
| 25(OH)D3 | ChEBI |
| 3-{2-[1-(5-HYDROXY-1,5-DIMETHYL-HEXYL)-7A-METHYL-OCTAHYDRO-INDEN-4-YLIDENE]-ETHYLIDENE}-4-METHYLENE-CYCLOHEXANOL | PDBeChem |
| (3S,5Z,7E)-9,10-secocholesta-5,7,10-triene-3,25-diol | PDBeChem |
| Brand Name | Source |
|---|---|
| Rayaldee | ChEBI |
| UniProt Name | Source |
|---|---|
| calcidiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 464 | DrugCentral |
| C01561 | KEGG COMPOUND |
| Calcifediol | Wikipedia |
| DB00146 | DrugBank |
| LMST03020246 | LIPID MAPS |
| VDY | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4270041 | Reaxys |
| CAS:19356-17-3 | ChemIDplus |
| CAS:19356-17-3 | KEGG COMPOUND |
| Citations |
|---|