EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H52O8 |
| Net Charge | 0 |
| Average Mass | 576.771 |
| Monoisotopic Mass | 576.36622 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)CCC1=C |
| InChI | InChI=1S/C33H52O8/c1-19-10-13-23(40-31-28(36)26(34)27(35)29(41-31)30(37)38)18-22(19)12-11-21-9-7-17-33(5)24(14-15-25(21)33)20(2)8-6-16-32(3,4)39/h11-12,20,23-29,31,34-36,39H,1,6-10,13-18H2,2-5H3,(H,37,38)/b21-11+,22-12-/t20-,23+,24-,25+,26+,27+,28-,29+,31-,33-/m1/s1 |
| InChIKey | RYOQRDXVFJRWFJ-VIVSZJOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | liver (BTO:0000759) | PubMed (24641623) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcidiol 3-O-(β-D-glucuronide) (CHEBI:139613) has functional parent calcidiol (CHEBI:17933) |
| calcidiol 3-O-(β-D-glucuronide) (CHEBI:139613) has role human xenobiotic metabolite (CHEBI:76967) |
| calcidiol 3-O-(β-D-glucuronide) (CHEBI:139613) is a D3 vitamins (CHEBI:73558) |
| calcidiol 3-O-(β-D-glucuronide) (CHEBI:139613) is a steroid glucosiduronic acid (CHEBI:26763) |
| calcidiol 3-O-(β-D-glucuronide) (CHEBI:139613) is a β-D-glucosiduronic acid (CHEBI:15341) |
| calcidiol 3-O-(β-D-glucuronide) (CHEBI:139613) is conjugate acid of calcidiol 3-O-(β-D-glucuronate) (CHEBI:139278) |
| Incoming Relation(s) |
| calcidiol 3-O-(β-D-glucuronate) (CHEBI:139278) is conjugate base of calcidiol 3-O-(β-D-glucuronide) (CHEBI:139613) |
| IUPAC Name |
|---|
| (1S,3Z)-3-[(2E)-2-{(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyloctahydro-4H-inden-4-ylidene}ethylidene]-4-methylidenecyclohexyl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 25-hydroxyvitamin D3 3-O-(β-D-glucuronic acid) | ChEBI |
| 25-hydroxyvitamin D3 3-O-(β-D-glucuronide) | ChEBI |
| 25-hydroxyvitamin D3 3-glucuronide | ChEBI |
| 25(OH)D33G | ChEBI |
| (3S,5Z,7E)-25-hydroxy-9,10-secocholesta-5,7,10(19)-trien-3-yl β-D-glucopyranosiduronic acid | ChEBI |
| calcidiol 3-O-glucoronide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7401269 | Reaxys |
| Citations |
|---|