EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H51O8 |
| Net Charge | -1 |
| Average Mass | 575.763 |
| Monoisotopic Mass | 575.35894 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)(C)O[C@@H]3O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]3O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C33H52O8/c1-19-10-13-23(34)18-22(19)12-11-21-9-7-17-33(5)24(14-15-25(21)33)20(2)8-6-16-32(3,4)41-31-28(37)26(35)27(36)29(40-31)30(38)39/h11-12,20,23-29,31,34-37H,1,6-10,13-18H2,2-5H3,(H,38,39)/p-1/b21-11+,22-12-/t20-,23+,24-,25+,26+,27+,28-,29+,31+,33-/m1/s1 |
| InChIKey | RQQPJTROOXJOLQ-IBWLQHGESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcidiol 25-O-(β-D-glucuronate) (CHEBI:139277) has functional parent calcidiol (CHEBI:17933) |
| calcidiol 25-O-(β-D-glucuronate) (CHEBI:139277) is a seco-cholestane conjugate (CHEBI:167104) |
| calcidiol 25-O-(β-D-glucuronate) (CHEBI:139277) is a steroid glucosiduronic acid anion (CHEBI:136637) |
| calcidiol 25-O-(β-D-glucuronate) (CHEBI:139277) is conjugate base of calcidiol 25-O-(β-D-glucuronide) (CHEBI:139610) |
| Incoming Relation(s) |
| calcidiol 25-O-(β-D-glucuronide) (CHEBI:139610) is conjugate acid of calcidiol 25-O-(β-D-glucuronate) (CHEBI:139277) |
| IUPAC Name |
|---|
| (6R)-6-[(1R,3aS,4E,7aR)-4-{(2Z)-2-[(5S)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene}-7a-methyloctahydro-1H-inden-1-yl]-2-methylheptan-2-yl β-D-glucopyranosiduronate |
| Synonyms | Source |
|---|---|
| 25-hydroxyvitamin D3 25-O-(β-D-glucuronate) | ChEBI |
| 25-hydroxyvitamin D3 25-O-(β-D-glucuronide)(1−) | SUBMITTER |
| (3S,5Z,7E)-9,10-secocholesta-5,7,10(19)-trien-3-ol 25-yl β-D-glucopyranosiduronate | ChEBI |
| calcidiol 25-O-(β-D-glucuronide)(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| calcidiol 25-O-(β-D-glucuronide) | UniProt |
| Citations |
|---|