EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NO |
| Net Charge | 0 |
| Average Mass | 185.226 |
| Monoisotopic Mass | 185.08406 |
| SMILES | ONc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H11NO/c14-13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13-14H |
| InChIKey | MYVLYOJYVMLSFA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxy-4-aminobiphenyl (CHEBI:16580) has functional parent biphenyl-4-amine (CHEBI:1784) |
| N-hydroxy-4-aminobiphenyl (CHEBI:16580) has role carcinogenic agent (CHEBI:50903) |
| N-hydroxy-4-aminobiphenyl (CHEBI:16580) has role human xenobiotic metabolite (CHEBI:76967) |
| N-hydroxy-4-aminobiphenyl (CHEBI:16580) is a N-substituted amine (CHEBI:35323) |
| N-hydroxy-4-aminobiphenyl (CHEBI:16580) is a aminobiphenyl (CHEBI:22496) |
| IUPAC Name |
|---|
| N-hydroxy-[1,1'-biphenyl]-4-amine |
| Synonyms | Source |
|---|---|
| 4-biphenylhydroxylamine | ChemIDplus |
| 4-hydroxyaminobiphenyl | ChemIDplus |
| 4-hydroxylaminobiphenyl | ChemIDplus |
| N-1,1'-biphenyl-4-ylhydroxylamine | ChEBI |
| N-4-biphenylylhydroxylamine | ChemIDplus |
| N-Hydroxy-4-aminobiphenyl | KEGG COMPOUND |
| Citations |
|---|