EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17709 - 5'-adenylyl sulfate
| Formula | C10H14N5O10PS |
| Net Charge | 0 |
| Average Mass | 427.288 |
| Monoisotopic Mass | 427.01990 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OS(=O)(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H14N5O10PS/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-26(18,19)25-27(20,21)22/h2-4,6-7,10,16-17H,1H2,(H,18,19)(H2,11,12,13)(H,20,21,22)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | IRLPACMLTUPBCL-KQYNXXCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-adenylyl sulfate (CHEBI:17709) has role Escherichia coli metabolite (CHEBI:76971) |
| 5'-adenylyl sulfate (CHEBI:17709) has role mouse metabolite (CHEBI:75771) |
| 5'-adenylyl sulfate (CHEBI:17709) is a acyl monophosphate (CHEBI:16826) |
| 5'-adenylyl sulfate (CHEBI:17709) is a acyl sulfate (CHEBI:37875) |
| 5'-adenylyl sulfate (CHEBI:17709) is a adenosine 5'-phosphate (CHEBI:37096) |
| 5'-adenylyl sulfate (CHEBI:17709) is conjugate acid of 5'-adenylyl sulfate(2−) (CHEBI:58243) |
| Incoming Relation(s) |
| 2'-phospho-5'-adenylyl sulfate (CHEBI:848) has functional parent 5'-adenylyl sulfate (CHEBI:17709) |
| 3'-phospho-5'-adenylyl sulfate (CHEBI:17980) has functional parent 5'-adenylyl sulfate (CHEBI:17709) |
| 5'-adenylyl sulfate(2−) (CHEBI:58243) is conjugate base of 5'-adenylyl sulfate (CHEBI:17709) |
| IUPAC Name |
|---|
| 5'-adenylyl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| Adenylylsulfate | KEGG COMPOUND |
| Adenosine 5'-phosphosulfate | KEGG COMPOUND |
| APS | KEGG COMPOUND |
| adenosine phosphosulfate | ChemIDplus |
| ADENOSINE-5'-PHOSPHOSULFATE | PDBeChem |
| 5'-Adenylyl sulfate | KEGG COMPOUND |