EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O10PS |
| Net Charge | -2 |
| Average Mass | 425.272 |
| Monoisotopic Mass | 425.00535 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OS(=O)(=O)[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H14N5O10PS/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-26(18,19)25-27(20,21)22/h2-4,6-7,10,16-17H,1H2,(H,18,19)(H2,11,12,13)(H,20,21,22)/p-2/t4-,6-,7-,10-/m1/s1 |
| InChIKey | IRLPACMLTUPBCL-KQYNXXCUSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-adenylyl sulfate(2−) (CHEBI:58243) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 5'-adenylyl sulfate(2−) (CHEBI:58243) has role human metabolite (CHEBI:77746) |
| 5'-adenylyl sulfate(2−) (CHEBI:58243) is a organophosphate oxoanion (CHEBI:58945) |
| 5'-adenylyl sulfate(2−) (CHEBI:58243) is a organosulfate oxoanion (CHEBI:58958) |
| 5'-adenylyl sulfate(2−) (CHEBI:58243) is conjugate base of 5'-adenylyl sulfate (CHEBI:17709) |
| Incoming Relation(s) |
| 5'-adenylyl sulfate (CHEBI:17709) is conjugate acid of 5'-adenylyl sulfate(2−) (CHEBI:58243) |
| IUPAC Name |
|---|
| 5'-O-[(sulfonatooxy)phosphinato]adenosine |
| Synonym | Source |
|---|---|
| 5'-adenylyl sulfate dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| adenosine 5'-phosphosulfate | UniProt |