EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N5O13P2S |
| Net Charge | 0 |
| Average Mass | 507.267 |
| Monoisotopic Mass | 506.98623 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OS(=O)(=O)O)[C@@H](OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C10H15N5O13P2S/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7(27-29(17,18)19)4(26-10)1-25-30(20,21)28-31(22,23)24/h2-4,6-7,10,16H,1H2,(H,20,21)(H2,11,12,13)(H2,17,18,19)(H,22,23,24)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | GACDQMDRPRGCTN-KQYNXXCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-phospho-5'-adenylyl sulfate (CHEBI:17980) has functional parent 5'-adenylyl sulfate (CHEBI:17709) |
| 3'-phospho-5'-adenylyl sulfate (CHEBI:17980) has functional parent adenosine 3',5'-bismonophosphate (CHEBI:17985) |
| 3'-phospho-5'-adenylyl sulfate (CHEBI:17980) has role Escherichia coli metabolite (CHEBI:76971) |
| 3'-phospho-5'-adenylyl sulfate (CHEBI:17980) has role mouse metabolite (CHEBI:75771) |
| 3'-phospho-5'-adenylyl sulfate (CHEBI:17980) is a acyl sulfate (CHEBI:37875) |
| 3'-phospho-5'-adenylyl sulfate (CHEBI:17980) is a adenosine bisphosphate (CHEBI:22251) |
| 3'-phospho-5'-adenylyl sulfate (CHEBI:17980) is a purine ribonucleoside bisphosphate (CHEBI:64620) |
| 3'-phospho-5'-adenylyl sulfate (CHEBI:17980) is conjugate acid of 3'-phosphonato-5'-adenylyl sulfate(4−) (CHEBI:58339) |
| Incoming Relation(s) |
| 3'-phosphonato-5'-adenylyl sulfate(4−) (CHEBI:58339) is conjugate base of 3'-phospho-5'-adenylyl sulfate (CHEBI:17980) |
| IUPAC Name |
|---|
| 3'-O-phosphono-5'-adenylyl sulfate |
| Synonyms | Source |
|---|---|
| 3'-Phosphoadenylyl sulfate | KEGG COMPOUND |
| 3'-Phosphoadenosine 5'-phosphosulfate | KEGG COMPOUND |
| 3'-Phospho-5'-adenylyl sulfate | KEGG COMPOUND |
| PAPS | KEGG COMPOUND |
| 3'-phospho-5'-adenylyl sulfate | ChEBI |
| 3'-phosphoadenosine 5'-phosphosulfate | ChEBI |