EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17655 - 4-hydroxy-2-oxopentanoic acid
| Formula | C5H8O4 |
| Net Charge | 0 |
| Average Mass | 132.115 |
| Monoisotopic Mass | 132.04226 |
| SMILES | CC(O)CC(=O)C(=O)O |
| InChI | InChI=1S/C5H8O4/c1-3(6)2-4(7)5(8)9/h3,6H,2H2,1H3,(H,8,9) |
| InChIKey | HFKQINMYQUXOCH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-2-oxopentanoic acid (CHEBI:17655) has functional parent valeric acid (CHEBI:17418) |
| 4-hydroxy-2-oxopentanoic acid (CHEBI:17655) has role Escherichia coli metabolite (CHEBI:76971) |
| 4-hydroxy-2-oxopentanoic acid (CHEBI:17655) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 4-hydroxy-2-oxopentanoic acid (CHEBI:17655) is a 4-hydroxy monocarboxylic acid (CHEBI:35970) |
| 4-hydroxy-2-oxopentanoic acid (CHEBI:17655) is conjugate acid of 4-hydroxy-2-oxopentanoate (CHEBI:58222) |
| Incoming Relation(s) |
| 5-chloro-4-hydroxy-2-oxopentanoic acid (CHEBI:74044) has functional parent 4-hydroxy-2-oxopentanoic acid (CHEBI:17655) |
| (S)-4-hydroxy-2-oxopentanoic acid (CHEBI:73148) is a 4-hydroxy-2-oxopentanoic acid (CHEBI:17655) |
| 4-hydroxy-2-oxopentanoate (CHEBI:58222) is conjugate base of 4-hydroxy-2-oxopentanoic acid (CHEBI:17655) |
| IUPAC Name |
|---|
| 4-hydroxy-2-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 4-Hydroxy-2-oxopentanoate | KEGG COMPOUND |
| 4-Hydroxy-2-oxovalerate | KEGG COMPOUND |