EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:74044 - 5-chloro-4-hydroxy-2-oxopentanoic acid
| Formula | C5H7ClO4 |
| Net Charge | 0 |
| Average Mass | 166.560 |
| Monoisotopic Mass | 166.00329 |
| SMILES | O=C(O)C(=O)CC(O)CCl |
| InChI | InChI=1S/C5H7ClO4/c6-2-3(7)1-4(8)5(9)10/h3,7H,1-2H2,(H,9,10) |
| InChIKey | FHWPHVIGZZAXIQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-chloro-4-hydroxy-2-oxopentanoic acid (CHEBI:74044) has functional parent 4-hydroxy-2-oxopentanoic acid (CHEBI:17655) |
| 5-chloro-4-hydroxy-2-oxopentanoic acid (CHEBI:74044) has role metabolite (CHEBI:25212) |
| 5-chloro-4-hydroxy-2-oxopentanoic acid (CHEBI:74044) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 5-chloro-4-hydroxy-2-oxopentanoic acid (CHEBI:74044) is a 4-hydroxy monocarboxylic acid (CHEBI:35970) |
| 5-chloro-4-hydroxy-2-oxopentanoic acid (CHEBI:74044) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 5-chloro-4-hydroxy-2-oxopentanoic acid |