EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O4 |
| Net Charge | 0 |
| Average Mass | 132.115 |
| Monoisotopic Mass | 132.04226 |
| SMILES | C[C@H](O)CC(=O)C(=O)O |
| InChI | InChI=1S/C5H8O4/c1-3(6)2-4(7)5(8)9/h3,6H,2H2,1H3,(H,8,9)/t3-/m0/s1 |
| InChIKey | HFKQINMYQUXOCH-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-4-hydroxy-2-oxopentanoic acid (CHEBI:73148) is a 4-hydroxy-2-oxopentanoic acid (CHEBI:17655) |
| (S)-4-hydroxy-2-oxopentanoic acid (CHEBI:73148) is conjugate acid of (S)-4-hydroxy-2-oxopentanoate (CHEBI:73143) |
| Incoming Relation(s) |
| (S)-4-hydroxy-2-oxopentanoate (CHEBI:73143) is conjugate base of (S)-4-hydroxy-2-oxopentanoic acid (CHEBI:73148) |
| IUPAC Name |
|---|
| (4S)-4-hydroxy-2-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| (4S)-4-hydroxy-2-ketovaleric acid | ChEBI |
| (4S)-4-hydroxy-2-oxovaleric acid | ChEBI |
| (S)-4-hydroxy-2-ketopentanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7803213 | Reaxys |
| Citations |
|---|