EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H32FeN4O4 |
| Net Charge | 0 |
| Average Mass | 616.499 |
| Monoisotopic Mass | 616.17729 |
| SMILES | C=CC1=C(C)C2=Cc3c(C=C)c(C)c4[n]3[Fe-2]35[n]6c(c(C)c(CCC(=O)O)c6=CC6=[N+]3C(=C4)C(C)=C6CCC(=O)O)=CC1=[N+]25 |
| InChI | InChI=1S/C34H34N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-; |
| InChIKey | KABFMIBPWCXCRK-RGGAHWMASA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferroheme b (CHEBI:17627) has role cofactor (CHEBI:23357) |
| ferroheme b (CHEBI:17627) has role human metabolite (CHEBI:77746) |
| ferroheme b (CHEBI:17627) is a ferroheme (CHEBI:38573) |
| ferroheme b (CHEBI:17627) is a heme b (CHEBI:26355) |
| ferroheme b (CHEBI:17627) is conjugate acid of ferroheme b(2−) (CHEBI:60344) |
| Incoming Relation(s) |
| heme d cis-diol (CHEBI:62811) has functional parent ferroheme b (CHEBI:17627) |
| heme d trans-diol (CHEBI:62812) has functional parent ferroheme b (CHEBI:17627) |
| ferrocytochrome b (CHEBI:5034) has part ferroheme b (CHEBI:17627) |
| ferroheme b(2−) (CHEBI:60344) is conjugate base of ferroheme b (CHEBI:17627) |
| IUPAC Name |
|---|
| (protoporphyrinato)iron(II) |
| Synonyms | Source |
|---|---|
| [3,7,12,17-tetramethyl-8,13-divinylporphyrin-2,18-dipropanoato(2−)]iron(II) | IUPAC |
| Fe(II) heme b | ChEBI |
| Fe(II)-heme b | ChEBI |
| [Fe(ppIX)] | IUPAC |
| Fe(ppIX) | ChEBI |
| ferroprotoheme | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:95291 | Gmelin |
| Beilstein:953574 | Beilstein |
| CAS:14875-96-8 | KEGG COMPOUND |
| CAS:14875-96-8 | ChemIDplus |
| Citations |
|---|