EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H30FeN4O4 |
| Net Charge | -2 |
| Average Mass | 614.483 |
| Monoisotopic Mass | 614.16274 |
| SMILES | C=CC1=C(C)C2=Cc3c(C=C)c(C)c4[n]3[Fe-2]35[n]6c(c(C)c(CCC(=O)[O-])c6=CC6=[N+]3C(=C4)C(C)=C6CCC(=O)[O-])=CC1=[N+]25 |
| InChI | InChI=1S/C34H34N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-4/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-; |
| InChIKey | KABFMIBPWCXCRK-RGGAHWMASA-J |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferroheme b(2−) (CHEBI:60344) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| ferroheme b(2−) (CHEBI:60344) has role cofactor (CHEBI:23357) |
| ferroheme b(2−) (CHEBI:60344) is a cyclic tetrapyrrole anion (CHEBI:58941) |
| ferroheme b(2−) (CHEBI:60344) is a dicarboxylic acid dianion (CHEBI:28965) |
| ferroheme b(2−) (CHEBI:60344) is conjugate base of ferroheme b (CHEBI:17627) |
| Incoming Relation(s) |
| ferroheme b (CHEBI:17627) is conjugate acid of ferroheme b(2−) (CHEBI:60344) |
| IUPAC Name |
|---|
| [3,3'-(3,7,12,17-tetramethyl-8,13-divinylporphyrin-2,18-diyl-κ4N21,N22,N23,N24)dipropanoato(4−)]ferrate(2−) |
| Synonym | Source |
|---|---|
| Fe(II)-heme b(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| heme b | UniProt |
| Manual Xrefs | Databases |
|---|---|
| PROTOHEME | MetaCyc |