EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H34FeN4O6 |
| Net Charge | 0 |
| Average Mass | 650.513 |
| Monoisotopic Mass | 650.18277 |
| SMILES | C=CC1=C(C)C2=[N+]3C1=Cc1c(C)c(C=C)c4[n]1[Fe-2]31[n]3c(c(C)c(CCC(=O)O)c3=CC3=[N+]1C(=C4)[C@@](C)(O)[C@@]3(O)CCC(=O)O)=C2 |
| InChI | InChI=1S/C34H36N4O6.Fe/c1-7-20-17(3)23-13-24-19(5)22(9-10-31(39)40)28(37-24)16-30-34(44,12-11-32(41)42)33(6,43)29(38-30)15-27-21(8-2)18(4)25(36-27)14-26(20)35-23;/h7-8,13-16,43-44H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/t33-,34-;/m1./s1 |
| InChIKey | GFRHEDKPMCXPFU-YDXXJHAFSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heme d trans-diol (CHEBI:62812) has functional parent ferroheme b (CHEBI:17627) |
| heme d trans-diol (CHEBI:62812) is a dicarboxylic acid (CHEBI:35692) |
| heme d trans-diol (CHEBI:62812) is a diol (CHEBI:23824) |
| heme d trans-diol (CHEBI:62812) is a ferroheme (CHEBI:38573) |
| heme d trans-diol (CHEBI:62812) is a metallochlorin (CHEBI:62804) |
| heme d trans-diol (CHEBI:62812) is a tertiary alcohol (CHEBI:26878) |
| heme d trans-diol (CHEBI:62812) is conjugate acid of heme d trans-diol(2−) (CHEBI:62813) |
| Incoming Relation(s) |
| heme d trans-diol(2−) (CHEBI:62813) is conjugate base of heme d trans-diol (CHEBI:62812) |
| IUPAC Name |
|---|
| {3,3'-[(2RS,3RS)-7,12-diethenyl-2,3-dihydroxy-3,8,13,17-tetramethyl-2,3-dihydroporphyrin-2,18-diyl-κ4N21,N22,N23,N24]dipropanoato(2−)}iron |
| Synonyms | Source |
|---|---|
| ferroheme d trans-diol | ChEBI |
| haem d trans-diol | ChEBI |
| Citations |
|---|