EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H34FeN4O6 |
| Net Charge | 0 |
| Average Mass | 650.513 |
| Monoisotopic Mass | 650.18277 |
| SMILES | C=CC1=C(C)C2=[N+]3C1=Cc1c(C)c(C=C)c4[n]1[Fe-2]31[n]3c(c(C)c(CCC(=O)O)c3=CC3=[N+]1C(=C4)[C@@](C)(O)[C@@]3(O)CCC(=O)O)=C2 |
| InChI | InChI=1S/C34H36N4O6.Fe/c1-7-20-17(3)23-13-24-19(5)22(9-10-31(39)40)28(37-24)16-30-34(44,12-11-32(41)42)33(6,43)29(38-30)15-27-21(8-2)18(4)25(36-27)14-26(20)35-23;/h7-8,13-16,43-44H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/t33-,34-;/m1./s1 |
| InChIKey | GFRHEDKPMCXPFU-YDXXJHAFSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heme d trans-diol (CHEBI:62812) has functional parent ferroheme b (CHEBI:17627) |
| heme d trans-diol (CHEBI:62812) is a dicarboxylic acid (CHEBI:35692) |
| heme d trans-diol (CHEBI:62812) is a diol (CHEBI:23824) |
| heme d trans-diol (CHEBI:62812) is a ferroheme (CHEBI:38573) |
| heme d trans-diol (CHEBI:62812) is a metallochlorin (CHEBI:62804) |
| heme d trans-diol (CHEBI:62812) is a tertiary alcohol (CHEBI:26878) |
| heme d trans-diol (CHEBI:62812) is conjugate acid of heme d trans-diol(2−) (CHEBI:62813) |
| Incoming Relation(s) |
| heme d trans-diol(2−) (CHEBI:62813) is conjugate base of heme d trans-diol (CHEBI:62812) |
| IUPAC Name |
|---|
| {3,3'-[(2RS,3RS)-7,12-diethenyl-2,3-dihydroxy-3,8,13,17-tetramethyl-2,3-dihydroporphyrin-2,18-diyl-κ4N21,N22,N23,N24]dipropanoato(2−)}iron |
| Synonyms | Source |
|---|---|
| haem d trans-diol | ChEBI |
| ferroheme d trans-diol | ChEBI |
| Citations |
|---|