EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H3NO4 |
| Net Charge | 0 |
| Average Mass | 117.060 |
| Monoisotopic Mass | 117.00621 |
| SMILES | O=C(O)/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C3H3NO4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)/b2-1+ |
| InChIKey | MBNRADMGBBUWJK-OWOJBTEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-nitroacrylic acid (CHEBI:17610) has functional parent acrylic acid (CHEBI:18308) |
| 3-nitroacrylic acid (CHEBI:17610) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| 3-nitroacrylic acid (CHEBI:17610) is conjugate acid of 3-nitroacrylate (CHEBI:58205) |
| Incoming Relation(s) |
| 3-nitroacrylate (CHEBI:58205) is conjugate base of 3-nitroacrylic acid (CHEBI:17610) |
| IUPAC Name |
|---|
| 3-nitroprop-2-enoic acid |
| Synonym | Source |
|---|---|
| 3-Nitroacrylate | KEGG COMPOUND |