EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H2NO4 |
| Net Charge | -1 |
| Average Mass | 116.052 |
| Monoisotopic Mass | 115.99893 |
| SMILES | O=C([O-])/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C3H3NO4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)/p-1/b2-1+ |
| InChIKey | MBNRADMGBBUWJK-OWOJBTEDSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-nitroacrylate (CHEBI:58205) is a monocarboxylic acid anion (CHEBI:35757) |
| 3-nitroacrylate (CHEBI:58205) is conjugate base of 3-nitroacrylic acid (CHEBI:17610) |
| Incoming Relation(s) |
| 3-nitroacrylic acid (CHEBI:17610) is conjugate acid of 3-nitroacrylate (CHEBI:58205) |
| IUPAC Name |
|---|
| (2E)-3-nitroprop-2-enoate |
| Synonyms | Source |
|---|---|
| (2E)-3-nitroacrylate | ChEBI |
| 3-nitroacrylate(1−) | ChEBI |
| 3-nitroacrylate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-nitroacrylate | UniProt |