EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O2 |
| Net Charge | 0 |
| Average Mass | 200.237 |
| Monoisotopic Mass | 200.08373 |
| SMILES | Oc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O2/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9,14H,10H2 |
| InChIKey | VYQNWZOUAUKGHI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Applications: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monobenzone (CHEBI:34380) has functional parent hydroquinone (CHEBI:17594) |
| monobenzone (CHEBI:34380) has role allergen (CHEBI:50904) |
| monobenzone (CHEBI:34380) has role dermatologic drug (CHEBI:50177) |
| monobenzone (CHEBI:34380) has role melanin synthesis inhibitor (CHEBI:64933) |
| monobenzone (CHEBI:34380) is a benzyl ether (CHEBI:59859) |
| IUPAC Name |
|---|
| 4-(benzyloxy)phenol |
| INNs | Source |
|---|---|
| monobenzonum | ChemIDplus |
| monobenzone | ChemIDplus |
| monobenzona | ChemIDplus |
| monobenzone | WHO MedNet |
| monobenzone | WHO MedNet |
| monobenzona | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-(Benzyloxyl)phenol | KEGG COMPOUND |
| 4-(Phenylmethoxy)phenol | KEGG COMPOUND |
| 4-Benzyloxy-phenol | ChEMBL |
| MONOBENZYL ETHER OF HYDROQUINONE | ChEMBL |
| Hydroquinone benzyl ether | ChemIDplus |
| Benzyl p-hydroxyphenyl ether | ChemIDplus |
| Citations |
|---|