EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5325 - gentisyl alcohol
| Formula | C7H8O3 |
| Net Charge | 0 |
| Average Mass | 140.138 |
| Monoisotopic Mass | 140.04734 |
| SMILES | OCc1cc(O)ccc1O |
| InChI | InChI=1S/C7H8O3/c8-4-5-3-6(9)1-2-7(5)10/h1-3,8-10H,4H2 |
| InChIKey | PUZSUVGRVHEUQO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus parasiticus (ncbitaxon:5067) | - | DOI (/10.1021/np010450k) | |
| Penicillium roqueforti (ncbitaxon:5082) | - | Article (Book: John W. Blunt, Murray H. G. Munro. Dictionary of Marine Natural Products with CD-ROM, D-597.) | |
| Penicillium novae-zeelandiae (ncbitaxon:434487) | - | PubMed (12948827) | |
| Phyllosticta sp. (ncbitaxon:1886407) | cell suspension culture (BTO:0000221) | DOI (/10.1271/bbb1961.35.1810) | |
| Arthrinium sp. (ncbitaxon:1756131) | - | PubMed (31163640) | |
| Phoma herbarum (ncbitaxon:73001) | - | PubMed (27288000) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gentisyl alcohol (CHEBI:5325) has functional parent benzyl alcohol (CHEBI:17987) |
| gentisyl alcohol (CHEBI:5325) has functional parent hydroquinone (CHEBI:17594) |
| gentisyl alcohol (CHEBI:5325) has role antineoplastic agent (CHEBI:35610) |
| gentisyl alcohol (CHEBI:5325) has role antioxidant (CHEBI:22586) |
| gentisyl alcohol (CHEBI:5325) has role apoptosis inhibitor (CHEBI:68494) |
| gentisyl alcohol (CHEBI:5325) has role fungal metabolite (CHEBI:76946) |
| gentisyl alcohol (CHEBI:5325) is a aromatic primary alcohol (CHEBI:33857) |
| gentisyl alcohol (CHEBI:5325) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-(hydroxymethyl)benzene-1,4-diol |
| Synonyms | Source |
|---|---|
| 3,6-dihydroxybenzyl alcohol | ChemIDplus |
| 2,5-dihydroxybenzyl alcohol | KEGG COMPOUND |
| 2-(hydroxymethyl)-1,4-benzenediol | ChemIDplus |
| salirepol | ChEBI |
| gentisin alcohol | ChEBI |
| UniProt Name | Source |
|---|---|
| gentisyl alcohol | UniProt |
| Citations |
|---|